C37H38F3N2O6+ — CID 158701982
1-[1-[2-(3,4-difluorophenyl)acetyl]cyclopropyl]-2-[3-fluoro-4-[6-methoxy-7-[3-(4-methylmorpholin-4-ium-4-yl)propoxy]quinolin-4-yl]oxyphenyl]ethanone (PubChem CID 158701982) has the molecular formula C37H38F3N2O6+ and a molecular weight of 663.71 g/mol. Its IUPAC name is 1-[1-[2-(3,4-difluorophenyl)acetyl]cyclopropyl]-2-[3-fluoro-4-[6-methoxy-7-[3-(4-methylmorpholin-4-ium-4-yl)propoxy]quinolin-4-yl]oxyphenyl]ethanone.
| Compound Name | 1-[1-[2-(3,4-difluorophenyl)acetyl]cyclopropyl]-2-[3-fluoro-4-[6-methoxy-7-[3-(4-methylmorpholin-4-ium-4-yl)propoxy]quinolin-4-yl]oxyphenyl]ethanone |
|---|---|
| PubChem CID | 158701982 |
| Molecular Formula | C37H38F3N2O6+ |
| Molecular Weight | 663.71 g/mol |
| Exact Mass | 663.27 |
| IUPAC Name | 1-[1-[2-(3,4-difluorophenyl)acetyl]cyclopropyl]-2-[3-fluoro-4-[6-methoxy-7-[3-(4-methylmorpholin-4-ium-4-yl)propoxy]quinolin-4-yl]oxyphenyl]ethanone |
| SMILES | COc1cc2c(Oc3ccc(CC(=O)C4(C(=O)Cc5ccc(F)c(F)c5)CC4)cc3F)ccnc2cc1OCCC[N+]1(C)CCOCC1 |
| InChI | InChI=1S/C37H38F3N2O6/c1-42(13-16-46-17-14-42)12-3-15-47-34-23-30-26(22-33(34)45-2)31(8-11-41-30)48-32-7-5-25(19-29(32)40)21-36(44)37(9-10-37)35(43)20-24-4-6-27(38)28(39)18-24/h4-8,11,18-19,22-23H,3,9-10,12-17,20-21H2,1-2H3/q+1 |
| InChIKey | UCZZRTNWEZUDQV-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 83.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.71 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|