C38H37F2NO6S — CID 165040423
S-[(E)-7-[4-[2-fluoro-4-[2-[1-[2-(4-fluorophenyl)acetyl]cyclopropyl]-2-oxoethyl]phenoxy]-6-methoxyquinolin-7-yl]oxyhept-4-enyl] ethanethioate (PubChem CID 165040423) has the molecular formula C38H37F2NO6S and a molecular weight of 673.78 g/mol. Its IUPAC name is S-[(E)-7-[4-[2-fluoro-4-[2-[1-[2-(4-fluorophenyl)acetyl]cyclopropyl]-2-oxoethyl]phenoxy]-6-methoxyquinolin-7-yl]oxyhept-4-enyl] ethanethioate.
| Compound Name | S-[(E)-7-[4-[2-fluoro-4-[2-[1-[2-(4-fluorophenyl)acetyl]cyclopropyl]-2-oxoethyl]phenoxy]-6-methoxyquinolin-7-yl]oxyhept-4-enyl] ethanethioate |
|---|---|
| PubChem CID | 165040423 |
| Molecular Formula | C38H37F2NO6S |
| Molecular Weight | 673.78 g/mol |
| Exact Mass | 673.23 |
| IUPAC Name | S-[(E)-7-[4-[2-fluoro-4-[2-[1-[2-(4-fluorophenyl)acetyl]cyclopropyl]-2-oxoethyl]phenoxy]-6-methoxyquinolin-7-yl]oxyhept-4-enyl] ethanethioate |
| SMILES | COc1cc2c(Oc3ccc(CC(=O)C4(C(=O)Cc5ccc(F)cc5)CC4)cc3F)ccnc2cc1OCC/C=C/CCCSC(C)=O |
| InChI | InChI=1S/C38H37F2NO6S/c1-25(42)48-19-7-5-3-4-6-18-46-35-24-31-29(23-34(35)45-2)32(14-17-41-31)47-33-13-10-27(20-30(33)40)22-37(44)38(15-16-38)36(43)21-26-8-11-28(39)12-9-26/h3-4,8-14,17,20,23-24H,5-7,15-16,18-19,21-22H2,1-2H3/b4-3+ |
| InChIKey | OAOGRCDLAWGIRT-ONEGZZNKSA-N |
| XLogP | 8.40 |
| TPSA | 91.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.78 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|