C32H28FNO5 — CID 159295377
1-[4-[4-[2-[1-[2-(4-fluorophenyl)acetyl]cyclopropyl]-2-oxoethyl]phenoxy]-6-methoxyquinolin-7-yl]propan-1-one (PubChem CID 159295377) has the molecular formula C32H28FNO5 and a molecular weight of 525.58 g/mol. Its IUPAC name is 1-[4-[4-[2-[1-[2-(4-fluorophenyl)acetyl]cyclopropyl]-2-oxoethyl]phenoxy]-6-methoxyquinolin-7-yl]propan-1-one.
| Compound Name | 1-[4-[4-[2-[1-[2-(4-fluorophenyl)acetyl]cyclopropyl]-2-oxoethyl]phenoxy]-6-methoxyquinolin-7-yl]propan-1-one |
|---|---|
| PubChem CID | 159295377 |
| Molecular Formula | C32H28FNO5 |
| Molecular Weight | 525.58 g/mol |
| Exact Mass | 525.20 |
| IUPAC Name | 1-[4-[4-[2-[1-[2-(4-fluorophenyl)acetyl]cyclopropyl]-2-oxoethyl]phenoxy]-6-methoxyquinolin-7-yl]propan-1-one |
| SMILES | CCC(=O)c1cc2nccc(Oc3ccc(CC(=O)C4(C(=O)Cc5ccc(F)cc5)CC4)cc3)c2cc1OC |
| InChI | InChI=1S/C32H28FNO5/c1-3-27(35)25-18-26-24(19-29(25)38-2)28(12-15-34-26)39-23-10-6-21(7-11-23)17-31(37)32(13-14-32)30(36)16-20-4-8-22(33)9-5-20/h4-12,15,18-19H,3,13-14,16-17H2,1-2H3 |
| InChIKey | LAQKVYVAYKUOAZ-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 82.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.58 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|