C27H21FN2O5 — CID 59151345
4-[4-[2-[1-[2-(4-fluorophenyl)acetyl]cyclopropyl]-2-oxoethyl]phenoxy]-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid (PubChem CID 59151345) has the molecular formula C27H21FN2O5 and a molecular weight of 472.47 g/mol. Its IUPAC name is 4-[4-[2-[1-[2-(4-fluorophenyl)acetyl]cyclopropyl]-2-oxoethyl]phenoxy]-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid.
| Compound Name | 4-[4-[2-[1-[2-(4-fluorophenyl)acetyl]cyclopropyl]-2-oxoethyl]phenoxy]-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 59151345 |
| Molecular Formula | C27H21FN2O5 |
| Molecular Weight | 472.47 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | 4-[4-[2-[1-[2-(4-fluorophenyl)acetyl]cyclopropyl]-2-oxoethyl]phenoxy]-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1cc2c(Oc3ccc(CC(=O)C4(C(=O)Cc5ccc(F)cc5)CC4)cc3)ccnc2[nH]1 |
| InChI | InChI=1S/C27H21FN2O5/c28-18-5-1-16(2-6-18)13-23(31)27(10-11-27)24(32)14-17-3-7-19(8-4-17)35-22-9-12-29-25-20(22)15-21(30-25)26(33)34/h1-9,12,15H,10-11,13-14H2,(H,29,30)(H,33,34) |
| InChIKey | IVQUGFDCMDNCKP-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 109.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.47 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|