C34H31FN6O4 — CID 68714456
1-N-[4-[[2-[[4-(dimethylamino)phenyl]methylcarbamoyl]-1H-pyrrolo[2,3-b]pyridin-4-yl]oxy]phenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 68714456) has the molecular formula C34H31FN6O4 and a molecular weight of 606.66 g/mol. Its IUPAC name is 1-N-[4-[[2-[[4-(dimethylamino)phenyl]methylcarbamoyl]-1H-pyrrolo[2,3-b]pyridin-4-yl]oxy]phenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N-[4-[[2-[[4-(dimethylamino)phenyl]methylcarbamoyl]-1H-pyrrolo[2,3-b]pyridin-4-yl]oxy]phenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 68714456 |
| Molecular Formula | C34H31FN6O4 |
| Molecular Weight | 606.66 g/mol |
| Exact Mass | 606.24 |
| IUPAC Name | 1-N-[4-[[2-[[4-(dimethylamino)phenyl]methylcarbamoyl]-1H-pyrrolo[2,3-b]pyridin-4-yl]oxy]phenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | CN(C)c1ccc(CNC(=O)c2cc3c(Oc4ccc(NC(=O)C5(C(=O)Nc6ccc(F)cc6)CC5)cc4)ccnc3[nH]2)cc1 |
| InChI | InChI=1S/C34H31FN6O4/c1-41(2)25-11-3-21(4-12-25)20-37-31(42)28-19-27-29(15-18-36-30(27)40-28)45-26-13-9-24(10-14-26)39-33(44)34(16-17-34)32(43)38-23-7-5-22(35)6-8-23/h3-15,18-19H,16-17,20H2,1-2H3,(H,36,40)(H,37,42)(H,38,43)(H,39,44) |
| InChIKey | RURRCQHATHWKNX-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 128.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.66 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|