C31H27FN2O5 — CID 172958252
1-[1-[2-(4-fluorophenyl)acetyl]cyclopropyl]-2-[4-[7-methoxy-6-[(E)-methoxyiminomethyl]quinolin-4-yl]oxyphenyl]ethanone (PubChem CID 172958252) has the molecular formula C31H27FN2O5 and a molecular weight of 526.56 g/mol. Its IUPAC name is 1-[1-[2-(4-fluorophenyl)acetyl]cyclopropyl]-2-[4-[7-methoxy-6-[(E)-methoxyiminomethyl]quinolin-4-yl]oxyphenyl]ethanone.
| Compound Name | 1-[1-[2-(4-fluorophenyl)acetyl]cyclopropyl]-2-[4-[7-methoxy-6-[(E)-methoxyiminomethyl]quinolin-4-yl]oxyphenyl]ethanone |
|---|---|
| PubChem CID | 172958252 |
| Molecular Formula | C31H27FN2O5 |
| Molecular Weight | 526.56 g/mol |
| Exact Mass | 526.19 |
| IUPAC Name | 1-[1-[2-(4-fluorophenyl)acetyl]cyclopropyl]-2-[4-[7-methoxy-6-[(E)-methoxyiminomethyl]quinolin-4-yl]oxyphenyl]ethanone |
| SMILES | CO/N=C/c1cc2c(Oc3ccc(CC(=O)C4(C(=O)Cc5ccc(F)cc5)CC4)cc3)ccnc2cc1OC |
| InChI | InChI=1S/C31H27FN2O5/c1-37-28-18-26-25(17-22(28)19-34-38-2)27(11-14-33-26)39-24-9-5-21(6-10-24)16-30(36)31(12-13-31)29(35)15-20-3-7-23(32)8-4-20/h3-11,14,17-19H,12-13,15-16H2,1-2H3/b34-19+ |
| InChIKey | UIXCELXSVOWEOH-ALQBTCKLSA-N |
| XLogP | 5.86 |
| TPSA | 87.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.56 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|