C32H31F2N3O5S — CID 162532592
1-N'-[3-fluoro-4-[6-methoxy-7-(5-sulfanylpentoxy)quinolin-4-yl]oxyphenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 162532592) has the molecular formula C32H31F2N3O5S and a molecular weight of 607.68 g/mol. Its IUPAC name is 1-N'-[3-fluoro-4-[6-methoxy-7-(5-sulfanylpentoxy)quinolin-4-yl]oxyphenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[3-fluoro-4-[6-methoxy-7-(5-sulfanylpentoxy)quinolin-4-yl]oxyphenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 162532592 |
| Molecular Formula | C32H31F2N3O5S |
| Molecular Weight | 607.68 g/mol |
| Exact Mass | 607.20 |
| IUPAC Name | 1-N'-[3-fluoro-4-[6-methoxy-7-(5-sulfanylpentoxy)quinolin-4-yl]oxyphenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | COc1cc2c(Oc3ccc(N(C(=O)C4(C(N)=O)CC4)c4ccc(F)cc4)cc3F)ccnc2cc1OCCCCCS |
| InChI | InChI=1S/C32H31F2N3O5S/c1-40-28-18-23-25(19-29(28)41-15-3-2-4-16-43)36-14-11-26(23)42-27-10-9-22(17-24(27)34)37(21-7-5-20(33)6-8-21)31(39)32(12-13-32)30(35)38/h5-11,14,17-19,43H,2-4,12-13,15-16H2,1H3,(H2,35,38) |
| InChIKey | ZHTVPYRMLBDNHL-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 103.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.68 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|