C33H32FN3O6 — CID 68636414
1-N'-[3-fluoro-4-[7-[3-(1-hydroxycyclopropyl)propoxy]-6-methoxyquinolin-4-yl]oxyphenyl]-1-N'-phenylcyclopropane-1,1-dicarboxamide (PubChem CID 68636414) has the molecular formula C33H32FN3O6 and a molecular weight of 585.63 g/mol. Its IUPAC name is 1-N'-[3-fluoro-4-[7-[3-(1-hydroxycyclopropyl)propoxy]-6-methoxyquinolin-4-yl]oxyphenyl]-1-N'-phenylcyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[3-fluoro-4-[7-[3-(1-hydroxycyclopropyl)propoxy]-6-methoxyquinolin-4-yl]oxyphenyl]-1-N'-phenylcyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 68636414 |
| Molecular Formula | C33H32FN3O6 |
| Molecular Weight | 585.63 g/mol |
| Exact Mass | 585.23 |
| IUPAC Name | 1-N'-[3-fluoro-4-[7-[3-(1-hydroxycyclopropyl)propoxy]-6-methoxyquinolin-4-yl]oxyphenyl]-1-N'-phenylcyclopropane-1,1-dicarboxamide |
| SMILES | COc1cc2c(Oc3ccc(N(C(=O)C4(C(N)=O)CC4)c4ccccc4)cc3F)ccnc2cc1OCCCC1(O)CC1 |
| InChI | InChI=1S/C33H32FN3O6/c1-41-28-19-23-25(20-29(28)42-17-5-11-32(40)12-13-32)36-16-10-26(23)43-27-9-8-22(18-24(27)34)37(21-6-3-2-4-7-21)31(39)33(14-15-33)30(35)38/h2-4,6-10,16,18-20,40H,5,11-15,17H2,1H3,(H2,35,38) |
| InChIKey | ICAXCFWOXQRFLQ-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 124.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.63 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|