C33H32FN3O9 — CID 175547685
1-N'-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide;pentanedioic acid (PubChem CID 175547685) has the molecular formula C33H32FN3O9 and a molecular weight of 633.63 g/mol. Its IUPAC name is 1-N'-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide;pentanedioic acid.
| Compound Name | 1-N'-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide;pentanedioic acid |
|---|---|
| PubChem CID | 175547685 |
| Molecular Formula | C33H32FN3O9 |
| Molecular Weight | 633.63 g/mol |
| Exact Mass | 633.21 |
| IUPAC Name | 1-N'-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide;pentanedioic acid |
| SMILES | COc1cc2nccc(Oc3ccc(N(C(=O)C4(C(N)=O)CC4)c4ccc(F)cc4)cc3)c2cc1OC.O=C(O)CCCC(=O)O |
| InChI | InChI=1S/C28H24FN3O5.C5H8O4/c1-35-24-15-21-22(16-25(24)36-2)31-14-11-23(21)37-20-9-7-19(8-10-20)32(18-5-3-17(29)4-6-18)27(34)28(12-13-28)26(30)33;6-4(7)2-1-3-5(8)9/h3-11,14-16H,12-13H2,1-2H3,(H2,30,33);1-3H2,(H,6,7)(H,8,9) |
| InChIKey | AQRPANGTBGDMOZ-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 178.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.63 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|