C29H27FN4O6S — CID 176719484
1-N'-[4-[6-(ethylsulfamoyl)-7-methoxyquinolin-4-yl]oxyphenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 176719484) has the molecular formula C29H27FN4O6S and a molecular weight of 578.62 g/mol. Its IUPAC name is 1-N'-[4-[6-(ethylsulfamoyl)-7-methoxyquinolin-4-yl]oxyphenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[4-[6-(ethylsulfamoyl)-7-methoxyquinolin-4-yl]oxyphenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 176719484 |
| Molecular Formula | C29H27FN4O6S |
| Molecular Weight | 578.62 g/mol |
| Exact Mass | 578.16 |
| IUPAC Name | 1-N'-[4-[6-(ethylsulfamoyl)-7-methoxyquinolin-4-yl]oxyphenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | CCNS(=O)(=O)c1cc2c(Oc3ccc(N(C(=O)C4(C(N)=O)CC4)c4ccc(F)cc4)cc3)ccnc2cc1OC |
| InChI | InChI=1S/C29H27FN4O6S/c1-3-33-41(37,38)26-16-22-23(17-25(26)39-2)32-15-12-24(22)40-21-10-8-20(9-11-21)34(19-6-4-18(30)5-7-19)28(36)29(13-14-29)27(31)35/h4-12,15-17,33H,3,13-14H2,1-2H3,(H2,31,35) |
| InChIKey | IEGVNQKGRXLSIE-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 140.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.62 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|