C30H28FN5O5 — CID 176719487
1-N'-[4-[6-carbamoyl-7-(2-methoxyethylamino)quinolin-4-yl]oxyphenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 176719487) has the molecular formula C30H28FN5O5 and a molecular weight of 557.58 g/mol. Its IUPAC name is 1-N'-[4-[6-carbamoyl-7-(2-methoxyethylamino)quinolin-4-yl]oxyphenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[4-[6-carbamoyl-7-(2-methoxyethylamino)quinolin-4-yl]oxyphenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 176719487 |
| Molecular Formula | C30H28FN5O5 |
| Molecular Weight | 557.58 g/mol |
| Exact Mass | 557.21 |
| IUPAC Name | 1-N'-[4-[6-carbamoyl-7-(2-methoxyethylamino)quinolin-4-yl]oxyphenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | COCCNc1cc2nccc(Oc3ccc(N(C(=O)C4(C(N)=O)CC4)c4ccc(F)cc4)cc3)c2cc1C(N)=O |
| InChI | InChI=1S/C30H28FN5O5/c1-40-15-14-35-25-17-24-22(16-23(25)27(32)37)26(10-13-34-24)41-21-8-6-20(7-9-21)36(19-4-2-18(31)3-5-19)29(39)30(11-12-30)28(33)38/h2-10,13,16-17,35H,11-12,14-15H2,1H3,(H2,32,37)(H2,33,38) |
| InChIKey | ZODDYCONGBYKCS-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 149.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.58 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|