C33H33F2N3O5S — CID 162532594
1-N'-[3-fluoro-4-[6-methoxy-7-(6-sulfanylhexoxy)quinolin-4-yl]oxyphenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 162532594) has the molecular formula C33H33F2N3O5S and a molecular weight of 621.71 g/mol. Its IUPAC name is 1-N'-[3-fluoro-4-[6-methoxy-7-(6-sulfanylhexoxy)quinolin-4-yl]oxyphenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[3-fluoro-4-[6-methoxy-7-(6-sulfanylhexoxy)quinolin-4-yl]oxyphenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 162532594 |
| Molecular Formula | C33H33F2N3O5S |
| Molecular Weight | 621.71 g/mol |
| Exact Mass | 621.21 |
| IUPAC Name | 1-N'-[3-fluoro-4-[6-methoxy-7-(6-sulfanylhexoxy)quinolin-4-yl]oxyphenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | COc1cc2c(Oc3ccc(N(C(=O)C4(C(N)=O)CC4)c4ccc(F)cc4)cc3F)ccnc2cc1OCCCCCCS |
| InChI | InChI=1S/C33H33F2N3O5S/c1-41-29-19-24-26(20-30(29)42-16-4-2-3-5-17-44)37-15-12-27(24)43-28-11-10-23(18-25(28)35)38(22-8-6-21(34)7-9-22)32(40)33(13-14-33)31(36)39/h6-12,15,18-20,44H,2-5,13-14,16-17H2,1H3,(H2,36,39) |
| InChIKey | ZZJUXAKPUZUOTG-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 103.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.71 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|