C32H31F2N5O7 — CID 90315395
1-N'-[3-fluoro-4-[6-[3-[[2-(hydroxyamino)-2-oxoethyl]amino]propoxy]-7-methoxyquinolin-4-yl]oxyphenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 90315395) has the molecular formula C32H31F2N5O7 and a molecular weight of 635.62 g/mol. Its IUPAC name is 1-N'-[3-fluoro-4-[6-[3-[[2-(hydroxyamino)-2-oxoethyl]amino]propoxy]-7-methoxyquinolin-4-yl]oxyphenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[3-fluoro-4-[6-[3-[[2-(hydroxyamino)-2-oxoethyl]amino]propoxy]-7-methoxyquinolin-4-yl]oxyphenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 90315395 |
| Molecular Formula | C32H31F2N5O7 |
| Molecular Weight | 635.62 g/mol |
| Exact Mass | 635.22 |
| IUPAC Name | 1-N'-[3-fluoro-4-[6-[3-[[2-(hydroxyamino)-2-oxoethyl]amino]propoxy]-7-methoxyquinolin-4-yl]oxyphenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | COc1cc2nccc(Oc3ccc(N(C(=O)C4(C(N)=O)CC4)c4ccc(F)cc4)cc3F)c2cc1OCCCNCC(=O)NO |
| InChI | InChI=1S/C32H31F2N5O7/c1-44-27-17-24-22(16-28(27)45-14-2-12-36-18-29(40)38-43)25(9-13-37-24)46-26-8-7-21(15-23(26)34)39(20-5-3-19(33)4-6-20)31(42)32(10-11-32)30(35)41/h3-9,13,15-17,36,43H,2,10-12,14,18H2,1H3,(H2,35,41)(H,38,40) |
| InChIKey | ZEPDSNBRZZMAQM-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 165.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.62 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|