C34H36F2N4O5S — CID 162532584
1-N'-[3-fluoro-4-[6-methoxy-7-[3-[methyl(3-sulfanylpropyl)amino]propoxy]quinolin-4-yl]oxyphenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 162532584) has the molecular formula C34H36F2N4O5S and a molecular weight of 650.75 g/mol. Its IUPAC name is 1-N'-[3-fluoro-4-[6-methoxy-7-[3-[methyl(3-sulfanylpropyl)amino]propoxy]quinolin-4-yl]oxyphenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[3-fluoro-4-[6-methoxy-7-[3-[methyl(3-sulfanylpropyl)amino]propoxy]quinolin-4-yl]oxyphenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 162532584 |
| Molecular Formula | C34H36F2N4O5S |
| Molecular Weight | 650.75 g/mol |
| Exact Mass | 650.24 |
| IUPAC Name | 1-N'-[3-fluoro-4-[6-methoxy-7-[3-[methyl(3-sulfanylpropyl)amino]propoxy]quinolin-4-yl]oxyphenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | COc1cc2c(Oc3ccc(N(C(=O)C4(C(N)=O)CC4)c4ccc(F)cc4)cc3F)ccnc2cc1OCCCN(C)CCCS |
| InChI | InChI=1S/C34H36F2N4O5S/c1-39(16-4-18-46)15-3-17-44-31-21-27-25(20-30(31)43-2)28(11-14-38-27)45-29-10-9-24(19-26(29)36)40(23-7-5-22(35)6-8-23)33(42)34(12-13-34)32(37)41/h5-11,14,19-21,46H,3-4,12-13,15-18H2,1-2H3,(H2,37,41) |
| InChIKey | WHIDFWBELZTQDZ-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.75 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|