C19H19N3O4 — CID 23084603
1-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-3-methylurea (PubChem CID 23084603) has the molecular formula C19H19N3O4 and a molecular weight of 353.38 g/mol. Its IUPAC name is 1-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-3-methylurea.
| Compound Name | 1-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-3-methylurea |
|---|---|
| PubChem CID | 23084603 |
| Molecular Formula | C19H19N3O4 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 1-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-3-methylurea |
| SMILES | CNC(=O)Nc1ccc(Oc2ccnc3cc(OC)c(OC)cc23)cc1 |
| InChI | InChI=1S/C19H19N3O4/c1-20-19(23)22-12-4-6-13(7-5-12)26-16-8-9-21-15-11-18(25-3)17(24-2)10-14(15)16/h4-11H,1-3H3,(H2,20,22,23) |
| InChIKey | DYVDYQJEFLOFJM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |