C26H22N2O6 — CID 22132633
methyl 4-[[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]carbamoyl]benzoate (PubChem CID 22132633) has the molecular formula C26H22N2O6 and a molecular weight of 458.47 g/mol. Its IUPAC name is methyl 4-[[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]carbamoyl]benzoate.
| Compound Name | methyl 4-[[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]carbamoyl]benzoate |
|---|---|
| PubChem CID | 22132633 |
| Molecular Formula | C26H22N2O6 |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | methyl 4-[[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]carbamoyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)Nc2ccc(Oc3ccnc4cc(OC)c(OC)cc34)cc2)cc1 |
| InChI | InChI=1S/C26H22N2O6/c1-31-23-14-20-21(15-24(23)32-2)27-13-12-22(20)34-19-10-8-18(9-11-19)28-25(29)16-4-6-17(7-5-16)26(30)33-3/h4-15H,1-3H3,(H,28,29) |
| InChIKey | XZNGZGVYVGFNPD-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |