C18H15NO5 — CID 22132796
4-(6,7-dimethoxyquinolin-4-yl)oxybenzoic acid (PubChem CID 22132796) has the molecular formula C18H15NO5 and a molecular weight of 325.32 g/mol. Its IUPAC name is 4-(6,7-dimethoxyquinolin-4-yl)oxybenzoic acid.
| Compound Name | 4-(6,7-dimethoxyquinolin-4-yl)oxybenzoic acid |
|---|---|
| PubChem CID | 22132796 |
| Molecular Formula | C18H15NO5 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 4-(6,7-dimethoxyquinolin-4-yl)oxybenzoic acid |
| SMILES | COc1cc2nccc(Oc3ccc(C(=O)O)cc3)c2cc1OC |
| InChI | InChI=1S/C18H15NO5/c1-22-16-9-13-14(10-17(16)23-2)19-8-7-15(13)24-12-5-3-11(4-6-12)18(20)21/h3-10H,1-2H3,(H,20,21) |
| InChIKey | OLZGBRIHYLKWTN-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |