C29H27NO5 — CID 58249515
1-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-5-(4-methylphenyl)pentane-2,4-dione (PubChem CID 58249515) has the molecular formula C29H27NO5 and a molecular weight of 469.54 g/mol. Its IUPAC name is 1-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-5-(4-methylphenyl)pentane-2,4-dione.
| Compound Name | 1-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-5-(4-methylphenyl)pentane-2,4-dione |
|---|---|
| PubChem CID | 58249515 |
| Molecular Formula | C29H27NO5 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | 1-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-5-(4-methylphenyl)pentane-2,4-dione |
| SMILES | COc1cc2nccc(Oc3ccc(CC(=O)CC(=O)Cc4ccc(C)cc4)cc3)c2cc1OC |
| InChI | InChI=1S/C29H27NO5/c1-19-4-6-20(7-5-19)14-22(31)16-23(32)15-21-8-10-24(11-9-21)35-27-12-13-30-26-18-29(34-3)28(33-2)17-25(26)27/h4-13,17-18H,14-16H2,1-3H3 |
| InChIKey | RNSDQSXFYBOQEH-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|