C19H17NO3 — CID 71122818
2-[4-(6,7-dimethylquinolin-4-yl)oxyphenyl]acetic acid (PubChem CID 71122818) has the molecular formula C19H17NO3 and a molecular weight of 307.35 g/mol. Its IUPAC name is 2-[4-(6,7-dimethylquinolin-4-yl)oxyphenyl]acetic acid.
| Compound Name | 2-[4-(6,7-dimethylquinolin-4-yl)oxyphenyl]acetic acid |
|---|---|
| PubChem CID | 71122818 |
| Molecular Formula | C19H17NO3 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 2-[4-(6,7-dimethylquinolin-4-yl)oxyphenyl]acetic acid |
| SMILES | Cc1cc2nccc(Oc3ccc(CC(=O)O)cc3)c2cc1C |
| InChI | InChI=1S/C19H17NO3/c1-12-9-16-17(10-13(12)2)20-8-7-18(16)23-15-5-3-14(4-6-15)11-19(21)22/h3-10H,11H2,1-2H3,(H,21,22) |
| InChIKey | XILQZIUOBHEEKK-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |