2-[4-(6,7-dimethylquinolin-4-yl)oxyphenyl]acetic acid

C19H17NO3 — CID 71122818

IUPAC2-[4-(6,7-dimethylquinolin-4-yl)oxyphenyl]acetic acid
SMILESCc1cc2nccc(Oc3ccc(CC(=O)O)cc3)c2cc1C
InChIInChI=1S/C19H17NO3/c1-12-9-16-17(10-13(12)2)20-8-7-18(16)23-15-5-3-14(4-6-15)11-19(21)22/h3-10H,11H2,1-2H3,(H,21,22)
InChIKeyXILQZIUOBHEEKK-UHFFFAOYSA-N
MW307.35 g/mol
LogP4.27
Rot. Bonds4

About 2-[4-(6,7-dimethylquinolin-4-yl)oxyphenyl]acetic acid

2-[4-(6,7-dimethylquinolin-4-yl)oxyphenyl]acetic acid (PubChem CID 71122818) has the molecular formula C19H17NO3 and a molecular weight of 307.35 g/mol. Its IUPAC name is 2-[4-(6,7-dimethylquinolin-4-yl)oxyphenyl]acetic acid.

Molecular Properties

Compound Name2-[4-(6,7-dimethylquinolin-4-yl)oxyphenyl]acetic acid
PubChem CID71122818
Molecular FormulaC19H17NO3
Molecular Weight307.35 g/mol
Exact Mass307.12
IUPAC Name2-[4-(6,7-dimethylquinolin-4-yl)oxyphenyl]acetic acid
SMILESCc1cc2nccc(Oc3ccc(CC(=O)O)cc3)c2cc1C
InChIInChI=1S/C19H17NO3/c1-12-9-16-17(10-13(12)2)20-8-7-18(16)23-15-5-3-14(4-6-15)11-19(21)22/h3-10H,11H2,1-2H3,(H,21,22)
InChIKeyXILQZIUOBHEEKK-UHFFFAOYSA-N
XLogP4.27
TPSA59.42 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500307.35
LogP ≤ 54.27
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-[4-(6,7-dimethylquinolin-4-yl)oxyphenyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[4-(6,7-dimethylquinolin-4-yl)oxyphenyl]acetic acid?
The IUPAC name of 2-[4-(6,7-dimethylquinolin-4-yl)oxyphenyl]acetic acid (CID 71122818) is 2-[4-(6,7-dimethylquinolin-4-yl)oxyphenyl]acetic acid.
What is the SMILES notation for 2-[4-(6,7-dimethylquinolin-4-yl)oxyphenyl]acetic acid?
The canonical SMILES for 2-[4-(6,7-dimethylquinolin-4-yl)oxyphenyl]acetic acid is Cc1cc2nccc(Oc3ccc(CC(=O)O)cc3)c2cc1C.
What is the InChIKey of 2-[4-(6,7-dimethylquinolin-4-yl)oxyphenyl]acetic acid?
The InChIKey is XILQZIUOBHEEKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17NO3/c1-12-9-16-17(10-13(12)2)20-8-7-18(16)23-15-5-3-14(4-6-15)11-19(21)22/h3-10H,11H2,1-2H3,(H,21,22).
What are the key properties of 2-[4-(6,7-dimethylquinolin-4-yl)oxyphenyl]acetic acid?
2-[4-(6,7-dimethylquinolin-4-yl)oxyphenyl]acetic acid has a molecular weight of 307.35 g/mol, XLogP of 4.27, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(6,7-dimethylquinolin-4-yl)oxyphenyl]acetic acid is sourced from PubChem (CID 71122818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).