C28H24ClNO5 — CID 58249375
1-(3-chlorophenyl)-5-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]pentane-2,4-dione (PubChem CID 58249375) has the molecular formula C28H24ClNO5 and a molecular weight of 489.96 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-5-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]pentane-2,4-dione.
| Compound Name | 1-(3-chlorophenyl)-5-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]pentane-2,4-dione |
|---|---|
| PubChem CID | 58249375 |
| Molecular Formula | C28H24ClNO5 |
| Molecular Weight | 489.96 g/mol |
| Exact Mass | 489.13 |
| IUPAC Name | 1-(3-chlorophenyl)-5-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]pentane-2,4-dione |
| SMILES | COc1cc2nccc(Oc3ccc(CC(=O)CC(=O)Cc4cccc(Cl)c4)cc3)c2cc1OC |
| InChI | InChI=1S/C28H24ClNO5/c1-33-27-16-24-25(17-28(27)34-2)30-11-10-26(24)35-23-8-6-18(7-9-23)13-21(31)15-22(32)14-19-4-3-5-20(29)12-19/h3-12,16-17H,13-15H2,1-2H3 |
| InChIKey | FWVORSVSVQPTAQ-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.96 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|