C26H23ClN2O4 — CID 142073553
N-(4-chlorophenyl)-3-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]propanamide (PubChem CID 142073553) has the molecular formula C26H23ClN2O4 and a molecular weight of 462.93 g/mol. Its IUPAC name is N-(4-chlorophenyl)-3-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]propanamide.
| Compound Name | N-(4-chlorophenyl)-3-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]propanamide |
|---|---|
| PubChem CID | 142073553 |
| Molecular Formula | C26H23ClN2O4 |
| Molecular Weight | 462.93 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | N-(4-chlorophenyl)-3-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]propanamide |
| SMILES | COc1cc2nccc(Oc3ccc(CCC(=O)Nc4ccc(Cl)cc4)cc3)c2cc1OC |
| InChI | InChI=1S/C26H23ClN2O4/c1-31-24-15-21-22(16-25(24)32-2)28-14-13-23(21)33-20-10-3-17(4-11-20)5-12-26(30)29-19-8-6-18(27)7-9-19/h3-4,6-11,13-16H,5,12H2,1-2H3,(H,29,30) |
| InChIKey | LOWGRBDLTXMRQD-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.93 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |