C28H26ClN3O6S — CID 87925157
2-(4-chlorophenoxy)-N-[[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]carbamoyl]-2-methyl-N-sulfanylpropanamide (PubChem CID 87925157) has the molecular formula C28H26ClN3O6S and a molecular weight of 568.05 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]carbamoyl]-2-methyl-N-sulfanylpropanamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]carbamoyl]-2-methyl-N-sulfanylpropanamide |
|---|---|
| PubChem CID | 87925157 |
| Molecular Formula | C28H26ClN3O6S |
| Molecular Weight | 568.05 g/mol |
| Exact Mass | 567.12 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]carbamoyl]-2-methyl-N-sulfanylpropanamide |
| SMILES | COc1cc2nccc(Oc3ccc(NC(=O)N(S)C(=O)C(C)(C)Oc4ccc(Cl)cc4)cc3)c2cc1OC |
| InChI | InChI=1S/C28H26ClN3O6S/c1-28(2,38-20-9-5-17(29)6-10-20)26(33)32(39)27(34)31-18-7-11-19(12-8-18)37-23-13-14-30-22-16-25(36-4)24(35-3)15-21(22)23/h5-16,39H,1-4H3,(H,31,34) |
| InChIKey | FANCXQATLGMRJG-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 99.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.05 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|