C30H31ClN4O6 — CID 162662388
7-[4-[4-[(2-chlorophenyl)carbamoylamino]phenoxy]-6-methoxyquinolin-7-yl]oxy-N-hydroxyheptanamide (PubChem CID 162662388) has the molecular formula C30H31ClN4O6 and a molecular weight of 579.05 g/mol. Its IUPAC name is 7-[4-[4-[(2-chlorophenyl)carbamoylamino]phenoxy]-6-methoxyquinolin-7-yl]oxy-N-hydroxyheptanamide.
| Compound Name | 7-[4-[4-[(2-chlorophenyl)carbamoylamino]phenoxy]-6-methoxyquinolin-7-yl]oxy-N-hydroxyheptanamide |
|---|---|
| PubChem CID | 162662388 |
| Molecular Formula | C30H31ClN4O6 |
| Molecular Weight | 579.05 g/mol |
| Exact Mass | 578.19 |
| IUPAC Name | 7-[4-[4-[(2-chlorophenyl)carbamoylamino]phenoxy]-6-methoxyquinolin-7-yl]oxy-N-hydroxyheptanamide |
| SMILES | COc1cc2c(Oc3ccc(NC(=O)Nc4ccccc4Cl)cc3)ccnc2cc1OCCCCCCC(=O)NO |
| InChI | InChI=1S/C30H31ClN4O6/c1-39-27-18-22-25(19-28(27)40-17-7-3-2-4-10-29(36)35-38)32-16-15-26(22)41-21-13-11-20(12-14-21)33-30(37)34-24-9-6-5-8-23(24)31/h5-6,8-9,11-16,18-19,38H,2-4,7,10,17H2,1H3,(H,35,36)(H2,33,34,37) |
| InChIKey | RXEVBSFWGCDHGL-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 131.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.05 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|