C31H32F3N5O7 — CID 175608816
1-[4-[7-[7-(2-hydroxyhydrazinyl)-7-oxoheptoxy]-6-methoxyquinolin-4-yl]oxyphenyl]-3-[4-(trifluoromethoxy)phenyl]urea (PubChem CID 175608816) has the molecular formula C31H32F3N5O7 and a molecular weight of 643.62 g/mol. Its IUPAC name is 1-[4-[7-[7-(2-hydroxyhydrazinyl)-7-oxoheptoxy]-6-methoxyquinolin-4-yl]oxyphenyl]-3-[4-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-[4-[7-[7-(2-hydroxyhydrazinyl)-7-oxoheptoxy]-6-methoxyquinolin-4-yl]oxyphenyl]-3-[4-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 175608816 |
| Molecular Formula | C31H32F3N5O7 |
| Molecular Weight | 643.62 g/mol |
| Exact Mass | 643.23 |
| IUPAC Name | 1-[4-[7-[7-(2-hydroxyhydrazinyl)-7-oxoheptoxy]-6-methoxyquinolin-4-yl]oxyphenyl]-3-[4-(trifluoromethoxy)phenyl]urea |
| SMILES | COc1cc2c(Oc3ccc(NC(=O)Nc4ccc(OC(F)(F)F)cc4)cc3)ccnc2cc1OCCCCCCC(=O)NNO |
| InChI | InChI=1S/C31H32F3N5O7/c1-43-27-18-24-25(19-28(27)44-17-5-3-2-4-6-29(40)38-39-42)35-16-15-26(24)45-22-11-7-20(8-12-22)36-30(41)37-21-9-13-23(14-10-21)46-31(32,33)34/h7-16,18-19,39,42H,2-6,17H2,1H3,(H,38,40)(H2,36,37,41) |
| InChIKey | NBZDOPYSMLHPGV-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 152.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.62 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|