C27H26ClN3O4 — CID 58674850
1-[4-[7-(3-chloropropoxy)-6-methylquinolin-4-yl]oxyphenyl]-3-(4-methoxyphenyl)urea (PubChem CID 58674850) has the molecular formula C27H26ClN3O4 and a molecular weight of 491.98 g/mol. Its IUPAC name is 1-[4-[7-(3-chloropropoxy)-6-methylquinolin-4-yl]oxyphenyl]-3-(4-methoxyphenyl)urea.
| Compound Name | 1-[4-[7-(3-chloropropoxy)-6-methylquinolin-4-yl]oxyphenyl]-3-(4-methoxyphenyl)urea |
|---|---|
| PubChem CID | 58674850 |
| Molecular Formula | C27H26ClN3O4 |
| Molecular Weight | 491.98 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | 1-[4-[7-(3-chloropropoxy)-6-methylquinolin-4-yl]oxyphenyl]-3-(4-methoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)Nc2ccc(Oc3ccnc4cc(OCCCCl)c(C)cc34)cc2)cc1 |
| InChI | InChI=1S/C27H26ClN3O4/c1-18-16-23-24(17-26(18)34-15-3-13-28)29-14-12-25(23)35-22-10-6-20(7-11-22)31-27(32)30-19-4-8-21(33-2)9-5-19/h4-12,14,16-17H,3,13,15H2,1-2H3,(H2,30,31,32) |
| InChIKey | VNVPEPMSCZPWEG-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.98 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|