C30H29N5O4 — CID 58930827
1-[4-[6-isocyano-7-(2-pyrrolidin-1-ylethoxy)quinolin-4-yl]oxyphenyl]-3-(4-methoxyphenyl)urea (PubChem CID 58930827) has the molecular formula C30H29N5O4 and a molecular weight of 523.59 g/mol. Its IUPAC name is 1-[4-[6-isocyano-7-(2-pyrrolidin-1-ylethoxy)quinolin-4-yl]oxyphenyl]-3-(4-methoxyphenyl)urea.
| Compound Name | 1-[4-[6-isocyano-7-(2-pyrrolidin-1-ylethoxy)quinolin-4-yl]oxyphenyl]-3-(4-methoxyphenyl)urea |
|---|---|
| PubChem CID | 58930827 |
| Molecular Formula | C30H29N5O4 |
| Molecular Weight | 523.59 g/mol |
| Exact Mass | 523.22 |
| IUPAC Name | 1-[4-[6-isocyano-7-(2-pyrrolidin-1-ylethoxy)quinolin-4-yl]oxyphenyl]-3-(4-methoxyphenyl)urea |
| SMILES | [C-]#[N+]c1cc2c(Oc3ccc(NC(=O)Nc4ccc(OC)cc4)cc3)ccnc2cc1OCCN1CCCC1 |
| InChI | InChI=1S/C30H29N5O4/c1-31-27-19-25-26(20-29(27)38-18-17-35-15-3-4-16-35)32-14-13-28(25)39-24-11-7-22(8-12-24)34-30(36)33-21-5-9-23(37-2)10-6-21/h5-14,19-20H,3-4,15-18H2,2H3,(H2,33,34,36) |
| InChIKey | GWUIHSXYOQJHPJ-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.59 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|