C31H42N4O5 — CID 23022632
1-(3,3-dimethylbutyl)-3-[4-[6-[3-(4-hydroxypiperidin-1-yl)propoxy]-7-methoxyquinolin-4-yl]oxyphenyl]urea (PubChem CID 23022632) has the molecular formula C31H42N4O5 and a molecular weight of 550.70 g/mol. Its IUPAC name is 1-(3,3-dimethylbutyl)-3-[4-[6-[3-(4-hydroxypiperidin-1-yl)propoxy]-7-methoxyquinolin-4-yl]oxyphenyl]urea.
| Compound Name | 1-(3,3-dimethylbutyl)-3-[4-[6-[3-(4-hydroxypiperidin-1-yl)propoxy]-7-methoxyquinolin-4-yl]oxyphenyl]urea |
|---|---|
| PubChem CID | 23022632 |
| Molecular Formula | C31H42N4O5 |
| Molecular Weight | 550.70 g/mol |
| Exact Mass | 550.32 |
| IUPAC Name | 1-(3,3-dimethylbutyl)-3-[4-[6-[3-(4-hydroxypiperidin-1-yl)propoxy]-7-methoxyquinolin-4-yl]oxyphenyl]urea |
| SMILES | COc1cc2nccc(Oc3ccc(NC(=O)NCCC(C)(C)C)cc3)c2cc1OCCCN1CCC(O)CC1 |
| InChI | InChI=1S/C31H42N4O5/c1-31(2,3)13-15-33-30(37)34-22-6-8-24(9-7-22)40-27-10-14-32-26-21-28(38-4)29(20-25(26)27)39-19-5-16-35-17-11-23(36)12-18-35/h6-10,14,20-21,23,36H,5,11-13,15-19H2,1-4H3,(H2,33,34,37) |
| InChIKey | JPJGFVAKQHRRKN-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 105.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.70 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|