C31H41ClN4O5 — CID 23022831
1-[3-chloro-4-[7-[3-(4-hydroxypiperidin-1-yl)propoxy]-6-methoxyquinolin-4-yl]oxyphenyl]-3-(3,3-dimethylbutyl)urea (PubChem CID 23022831) has the molecular formula C31H41ClN4O5 and a molecular weight of 585.15 g/mol. Its IUPAC name is 1-[3-chloro-4-[7-[3-(4-hydroxypiperidin-1-yl)propoxy]-6-methoxyquinolin-4-yl]oxyphenyl]-3-(3,3-dimethylbutyl)urea.
| Compound Name | 1-[3-chloro-4-[7-[3-(4-hydroxypiperidin-1-yl)propoxy]-6-methoxyquinolin-4-yl]oxyphenyl]-3-(3,3-dimethylbutyl)urea |
|---|---|
| PubChem CID | 23022831 |
| Molecular Formula | C31H41ClN4O5 |
| Molecular Weight | 585.15 g/mol |
| Exact Mass | 584.28 |
| IUPAC Name | 1-[3-chloro-4-[7-[3-(4-hydroxypiperidin-1-yl)propoxy]-6-methoxyquinolin-4-yl]oxyphenyl]-3-(3,3-dimethylbutyl)urea |
| SMILES | COc1cc2c(Oc3ccc(NC(=O)NCCC(C)(C)C)cc3Cl)ccnc2cc1OCCCN1CCC(O)CC1 |
| InChI | InChI=1S/C31H41ClN4O5/c1-31(2,3)11-13-34-30(38)35-21-6-7-27(24(32)18-21)41-26-8-12-33-25-20-29(28(39-4)19-23(25)26)40-17-5-14-36-15-9-22(37)10-16-36/h6-8,12,18-20,22,37H,5,9-11,13-17H2,1-4H3,(H2,34,35,38) |
| InChIKey | ZYHDYFZLFCQWQS-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 105.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.15 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|