C30H31Cl3N4O5S — CID 67074092
2,6-dichloro-N-[3-chloro-4-[6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinolin-4-yl]oxyphenyl]benzenesulfonamide (PubChem CID 67074092) has the molecular formula C30H31Cl3N4O5S and a molecular weight of 666.03 g/mol. Its IUPAC name is 2,6-dichloro-N-[3-chloro-4-[6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinolin-4-yl]oxyphenyl]benzenesulfonamide.
| Compound Name | 2,6-dichloro-N-[3-chloro-4-[6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinolin-4-yl]oxyphenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 67074092 |
| Molecular Formula | C30H31Cl3N4O5S |
| Molecular Weight | 666.03 g/mol |
| Exact Mass | 664.11 |
| IUPAC Name | 2,6-dichloro-N-[3-chloro-4-[6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinolin-4-yl]oxyphenyl]benzenesulfonamide |
| SMILES | COc1cc2c(Oc3ccc(NS(=O)(=O)c4c(Cl)cccc4Cl)cc3Cl)ccnc2cc1OCCCN1CCN(C)CC1 |
| InChI | InChI=1S/C30H31Cl3N4O5S/c1-36-12-14-37(15-13-36)11-4-16-41-29-19-25-21(18-28(29)40-2)26(9-10-34-25)42-27-8-7-20(17-24(27)33)35-43(38,39)30-22(31)5-3-6-23(30)32/h3,5-10,17-19,35H,4,11-16H2,1-2H3 |
| InChIKey | KPCUVZQAGSYDCW-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 93.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.03 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|