C30H34N4O6S — CID 70938682
2-hydroxy-N-[3-[6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinolin-4-yl]oxyphenyl]benzenesulfonamide (PubChem CID 70938682) has the molecular formula C30H34N4O6S and a molecular weight of 578.69 g/mol. Its IUPAC name is 2-hydroxy-N-[3-[6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinolin-4-yl]oxyphenyl]benzenesulfonamide.
| Compound Name | 2-hydroxy-N-[3-[6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinolin-4-yl]oxyphenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 70938682 |
| Molecular Formula | C30H34N4O6S |
| Molecular Weight | 578.69 g/mol |
| Exact Mass | 578.22 |
| IUPAC Name | 2-hydroxy-N-[3-[6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinolin-4-yl]oxyphenyl]benzenesulfonamide |
| SMILES | COc1cc2c(Oc3cccc(NS(=O)(=O)c4ccccc4O)c3)ccnc2cc1OCCCN1CCN(C)CC1 |
| InChI | InChI=1S/C30H34N4O6S/c1-33-14-16-34(17-15-33)13-6-18-39-29-21-25-24(20-28(29)38-2)27(11-12-31-25)40-23-8-5-7-22(19-23)32-41(36,37)30-10-4-3-9-26(30)35/h3-5,7-12,19-21,32,35H,6,13-18H2,1-2H3 |
| InChIKey | NTCJCFOTFJKQRB-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 113.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.69 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|