C30H39FN4O5 — CID 69060807
1-(3,3-dimethylbutyl)-3-[3-fluoro-4-[7-[2-(4-hydroxypiperidin-1-yl)ethoxymethoxy]quinolin-4-yl]oxyphenyl]urea (PubChem CID 69060807) has the molecular formula C30H39FN4O5 and a molecular weight of 554.66 g/mol. Its IUPAC name is 1-(3,3-dimethylbutyl)-3-[3-fluoro-4-[7-[2-(4-hydroxypiperidin-1-yl)ethoxymethoxy]quinolin-4-yl]oxyphenyl]urea.
| Compound Name | 1-(3,3-dimethylbutyl)-3-[3-fluoro-4-[7-[2-(4-hydroxypiperidin-1-yl)ethoxymethoxy]quinolin-4-yl]oxyphenyl]urea |
|---|---|
| PubChem CID | 69060807 |
| Molecular Formula | C30H39FN4O5 |
| Molecular Weight | 554.66 g/mol |
| Exact Mass | 554.29 |
| IUPAC Name | 1-(3,3-dimethylbutyl)-3-[3-fluoro-4-[7-[2-(4-hydroxypiperidin-1-yl)ethoxymethoxy]quinolin-4-yl]oxyphenyl]urea |
| SMILES | CC(C)(C)CCNC(=O)Nc1ccc(Oc2ccnc3cc(OCOCCN4CCC(O)CC4)ccc23)c(F)c1 |
| InChI | InChI=1S/C30H39FN4O5/c1-30(2,3)11-13-33-29(37)34-21-4-7-28(25(31)18-21)40-27-8-12-32-26-19-23(5-6-24(26)27)39-20-38-17-16-35-14-9-22(36)10-15-35/h4-8,12,18-19,22,36H,9-11,13-17,20H2,1-3H3,(H2,33,34,37) |
| InChIKey | NZZCCMKGTDNSOQ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 105.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.66 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|