C31H43ClN4O4 — CID 23022657
1-(3,3-dimethylbutyl)-3-[4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinolin-4-yl]oxyphenyl]urea;hydrochloride (PubChem CID 23022657) has the molecular formula C31H43ClN4O4 and a molecular weight of 571.16 g/mol. Its IUPAC name is 1-(3,3-dimethylbutyl)-3-[4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinolin-4-yl]oxyphenyl]urea;hydrochloride.
| Compound Name | 1-(3,3-dimethylbutyl)-3-[4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinolin-4-yl]oxyphenyl]urea;hydrochloride |
|---|---|
| PubChem CID | 23022657 |
| Molecular Formula | C31H43ClN4O4 |
| Molecular Weight | 571.16 g/mol |
| Exact Mass | 570.30 |
| IUPAC Name | 1-(3,3-dimethylbutyl)-3-[4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinolin-4-yl]oxyphenyl]urea;hydrochloride |
| SMILES | COc1cc2c(Oc3ccc(NC(=O)NCCC(C)(C)C)cc3)ccnc2cc1OCCCN1CCCCC1.Cl |
| InChI | InChI=1S/C31H42N4O4.ClH/c1-31(2,3)14-16-33-30(36)34-23-9-11-24(12-10-23)39-27-13-15-32-26-22-29(28(37-4)21-25(26)27)38-20-8-19-35-17-6-5-7-18-35;/h9-13,15,21-22H,5-8,14,16-20H2,1-4H3,(H2,33,34,36);1H |
| InChIKey | ASGLMNWOCNUAGK-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 84.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.16 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|