C26H31Cl2N3O4 — CID 23022693
1-[2-chloro-4-[7-(3-chloropropoxy)-6-methoxyquinolin-4-yl]oxyphenyl]-3-(3,3-dimethylbutyl)urea (PubChem CID 23022693) has the molecular formula C26H31Cl2N3O4 and a molecular weight of 520.46 g/mol. Its IUPAC name is 1-[2-chloro-4-[7-(3-chloropropoxy)-6-methoxyquinolin-4-yl]oxyphenyl]-3-(3,3-dimethylbutyl)urea.
| Compound Name | 1-[2-chloro-4-[7-(3-chloropropoxy)-6-methoxyquinolin-4-yl]oxyphenyl]-3-(3,3-dimethylbutyl)urea |
|---|---|
| PubChem CID | 23022693 |
| Molecular Formula | C26H31Cl2N3O4 |
| Molecular Weight | 520.46 g/mol |
| Exact Mass | 519.17 |
| IUPAC Name | 1-[2-chloro-4-[7-(3-chloropropoxy)-6-methoxyquinolin-4-yl]oxyphenyl]-3-(3,3-dimethylbutyl)urea |
| SMILES | COc1cc2c(Oc3ccc(NC(=O)NCCC(C)(C)C)c(Cl)c3)ccnc2cc1OCCCCl |
| InChI | InChI=1S/C26H31Cl2N3O4/c1-26(2,3)9-12-30-25(32)31-20-7-6-17(14-19(20)28)35-22-8-11-29-21-16-24(34-13-5-10-27)23(33-4)15-18(21)22/h6-8,11,14-16H,5,9-10,12-13H2,1-4H3,(H2,30,31,32) |
| InChIKey | XZQOJFCQNRZJNY-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.46 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|