C28H36ClN3O6 — CID 144685795
1-[2-chloro-4-[7-[3-(3-ethoxypropoxy)propoxy]-6-methoxyquinolin-4-yl]oxyphenyl]-3-propan-2-ylurea (PubChem CID 144685795) has the molecular formula C28H36ClN3O6 and a molecular weight of 546.06 g/mol. Its IUPAC name is 1-[2-chloro-4-[7-[3-(3-ethoxypropoxy)propoxy]-6-methoxyquinolin-4-yl]oxyphenyl]-3-propan-2-ylurea.
| Compound Name | 1-[2-chloro-4-[7-[3-(3-ethoxypropoxy)propoxy]-6-methoxyquinolin-4-yl]oxyphenyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 144685795 |
| Molecular Formula | C28H36ClN3O6 |
| Molecular Weight | 546.06 g/mol |
| Exact Mass | 545.23 |
| IUPAC Name | 1-[2-chloro-4-[7-[3-(3-ethoxypropoxy)propoxy]-6-methoxyquinolin-4-yl]oxyphenyl]-3-propan-2-ylurea |
| SMILES | CCOCCCOCCCOc1cc2nccc(Oc3ccc(NC(=O)NC(C)C)c(Cl)c3)c2cc1OC |
| InChI | InChI=1S/C28H36ClN3O6/c1-5-35-12-6-13-36-14-7-15-37-27-18-24-21(17-26(27)34-4)25(10-11-30-24)38-20-8-9-23(22(29)16-20)32-28(33)31-19(2)3/h8-11,16-19H,5-7,12-15H2,1-4H3,(H2,31,32,33) |
| InChIKey | CKAASLHDGJQSKE-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 100.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.06 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|