C23H23ClN4O8S — CID 86603570
1-[2-chloro-4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-3-(5-methyl-1,2-oxazol-3-yl)urea;methanesulfonic acid (PubChem CID 86603570) has the molecular formula C23H23ClN4O8S and a molecular weight of 550.98 g/mol. Its IUPAC name is 1-[2-chloro-4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-3-(5-methyl-1,2-oxazol-3-yl)urea;methanesulfonic acid.
| Compound Name | 1-[2-chloro-4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-3-(5-methyl-1,2-oxazol-3-yl)urea;methanesulfonic acid |
|---|---|
| PubChem CID | 86603570 |
| Molecular Formula | C23H23ClN4O8S |
| Molecular Weight | 550.98 g/mol |
| Exact Mass | 550.09 |
| IUPAC Name | 1-[2-chloro-4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-3-(5-methyl-1,2-oxazol-3-yl)urea;methanesulfonic acid |
| SMILES | COc1cc2nccc(Oc3ccc(NC(=O)Nc4cc(C)on4)c(Cl)c3)c2cc1OC.CS(=O)(=O)O |
| InChI | InChI=1S/C22H19ClN4O5.CH4O3S/c1-12-8-21(27-32-12)26-22(28)25-16-5-4-13(9-15(16)23)31-18-6-7-24-17-11-20(30-3)19(29-2)10-14(17)18;1-5(2,3)4/h4-11H,1-3H3,(H2,25,26,27,28);1H3,(H,2,3,4) |
| InChIKey | GUIRSARANAAPNE-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 162.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.98 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|