C30H29ClF2N4O5 — CID 22667181
1-[2-chloro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]-3-(2,4-difluorophenyl)urea (PubChem CID 22667181) has the molecular formula C30H29ClF2N4O5 and a molecular weight of 599.03 g/mol. Its IUPAC name is 1-[2-chloro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]-3-(2,4-difluorophenyl)urea.
| Compound Name | 1-[2-chloro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]-3-(2,4-difluorophenyl)urea |
|---|---|
| PubChem CID | 22667181 |
| Molecular Formula | C30H29ClF2N4O5 |
| Molecular Weight | 599.03 g/mol |
| Exact Mass | 598.18 |
| IUPAC Name | 1-[2-chloro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]-3-(2,4-difluorophenyl)urea |
| SMILES | COc1cc2c(Oc3ccc(NC(=O)Nc4ccc(F)cc4F)c(Cl)c3)ccnc2cc1OCCCN1CCOCC1 |
| InChI | InChI=1S/C30H29ClF2N4O5/c1-39-28-17-21-26(18-29(28)41-12-2-9-37-10-13-40-14-11-37)34-8-7-27(21)42-20-4-6-24(22(31)16-20)35-30(38)36-25-5-3-19(32)15-23(25)33/h3-8,15-18H,2,9-14H2,1H3,(H2,35,36,38) |
| InChIKey | YRLVKWKKIIACIB-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 94.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.03 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|