C34H33F3N4O7 — CID 71285998
3-N'-[2,5-difluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]-3-N-(4-fluorophenyl)oxetane-3,3-dicarboxamide (PubChem CID 71285998) has the molecular formula C34H33F3N4O7 and a molecular weight of 666.65 g/mol. Its IUPAC name is 3-N'-[2,5-difluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]-3-N-(4-fluorophenyl)oxetane-3,3-dicarboxamide.
| Compound Name | 3-N'-[2,5-difluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]-3-N-(4-fluorophenyl)oxetane-3,3-dicarboxamide |
|---|---|
| PubChem CID | 71285998 |
| Molecular Formula | C34H33F3N4O7 |
| Molecular Weight | 666.65 g/mol |
| Exact Mass | 666.23 |
| IUPAC Name | 3-N'-[2,5-difluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]-3-N-(4-fluorophenyl)oxetane-3,3-dicarboxamide |
| SMILES | COc1cc2c(Oc3cc(F)c(NC(=O)C4(C(=O)Nc5ccc(F)cc5)COC4)cc3F)ccnc2cc1OCCCN1CCOCC1 |
| InChI | InChI=1S/C34H33F3N4O7/c1-44-30-15-23-26(18-31(30)47-12-2-9-41-10-13-45-14-11-41)38-8-7-28(23)48-29-17-24(36)27(16-25(29)37)40-33(43)34(19-46-20-34)32(42)39-22-5-3-21(35)4-6-22/h3-8,15-18H,2,9-14,19-20H2,1H3,(H,39,42)(H,40,43) |
| InChIKey | VQPYFHSQZZPAOL-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 120.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.65 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|