C28H22F3N3O6 — CID 71286110
3-N'-[4-(6,7-dimethoxyquinolin-4-yl)oxy-2,5-difluorophenyl]-3-N-(4-fluorophenyl)oxetane-3,3-dicarboxamide (PubChem CID 71286110) has the molecular formula C28H22F3N3O6 and a molecular weight of 553.49 g/mol. Its IUPAC name is 3-N'-[4-(6,7-dimethoxyquinolin-4-yl)oxy-2,5-difluorophenyl]-3-N-(4-fluorophenyl)oxetane-3,3-dicarboxamide.
| Compound Name | 3-N'-[4-(6,7-dimethoxyquinolin-4-yl)oxy-2,5-difluorophenyl]-3-N-(4-fluorophenyl)oxetane-3,3-dicarboxamide |
|---|---|
| PubChem CID | 71286110 |
| Molecular Formula | C28H22F3N3O6 |
| Molecular Weight | 553.49 g/mol |
| Exact Mass | 553.15 |
| IUPAC Name | 3-N'-[4-(6,7-dimethoxyquinolin-4-yl)oxy-2,5-difluorophenyl]-3-N-(4-fluorophenyl)oxetane-3,3-dicarboxamide |
| SMILES | COc1cc2nccc(Oc3cc(F)c(NC(=O)C4(C(=O)Nc5ccc(F)cc5)COC4)cc3F)c2cc1OC |
| InChI | InChI=1S/C28H22F3N3O6/c1-37-24-9-17-20(12-25(24)38-2)32-8-7-22(17)40-23-11-18(30)21(10-19(23)31)34-27(36)28(13-39-14-28)26(35)33-16-5-3-15(29)4-6-16/h3-12H,13-14H2,1-2H3,(H,33,35)(H,34,36) |
| InChIKey | ZAKQUUMEDCEQTD-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 108.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.49 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|