C35H36F2N4O6 — CID 130421936
trans-(1S,2R)-1-N'-[3-fluoro-5-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]-1-N-(4-fluorophenyl)-2-methylcyclopropane-1,1-dicarboxamide (PubChem CID 130421936) has the molecular formula C35H36F2N4O6 and a molecular weight of 646.69 g/mol. Its IUPAC name is trans-(1S,2R)-1-N'-[3-fluoro-5-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]-1-N-(4-fluorophenyl)-2-methylcyclopropane-1,1-dicarboxamide.
| Compound Name | trans-(1S,2R)-1-N'-[3-fluoro-5-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]-1-N-(4-fluorophenyl)-2-methylcyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 130421936 |
| Molecular Formula | C35H36F2N4O6 |
| Molecular Weight | 646.69 g/mol |
| Exact Mass | 646.26 |
| IUPAC Name | trans-(1S,2R)-1-N'-[3-fluoro-5-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]-1-N-(4-fluorophenyl)-2-methylcyclopropane-1,1-dicarboxamide |
| SMILES | COc1cc2c(Oc3cc(F)cc(NC(=O)[C@@]4(C(=O)Nc5ccc(F)cc5)C[C@H]4C)c3)ccnc2cc1OCCCN1CCOCC1 |
| InChI | InChI=1S/C35H36F2N4O6/c1-22-21-35(22,33(42)39-25-6-4-23(36)5-7-25)34(43)40-26-16-24(37)17-27(18-26)47-30-8-9-38-29-20-32(31(44-2)19-28(29)30)46-13-3-10-41-11-14-45-15-12-41/h4-9,16-20,22H,3,10-15,21H2,1-2H3,(H,39,42)(H,40,43)/t22-,35+/m1/s1 |
| InChIKey | TWQWBVDEZMJPQC-DGOBPVDHSA-N |
| XLogP | 6.02 |
| TPSA | 111.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.69 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|