C32H34F2N4O5 — CID 10348434
1-[1-(3,4-difluorophenyl)ethyl]-3-[4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]urea (PubChem CID 10348434) has the molecular formula C32H34F2N4O5 and a molecular weight of 592.64 g/mol. Its IUPAC name is 1-[1-(3,4-difluorophenyl)ethyl]-3-[4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]urea.
| Compound Name | 1-[1-(3,4-difluorophenyl)ethyl]-3-[4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]urea |
|---|---|
| PubChem CID | 10348434 |
| Molecular Formula | C32H34F2N4O5 |
| Molecular Weight | 592.64 g/mol |
| Exact Mass | 592.25 |
| IUPAC Name | 1-[1-(3,4-difluorophenyl)ethyl]-3-[4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]urea |
| SMILES | COc1cc2c(Oc3ccc(NC(=O)NC(C)c4ccc(F)c(F)c4)cc3)ccnc2cc1OCCCN1CCOCC1 |
| InChI | InChI=1S/C32H34F2N4O5/c1-21(22-4-9-26(33)27(34)18-22)36-32(39)37-23-5-7-24(8-6-23)43-29-10-11-35-28-20-31(30(40-2)19-25(28)29)42-15-3-12-38-13-16-41-17-14-38/h4-11,18-21H,3,12-17H2,1-2H3,(H2,36,37,39) |
| InChIKey | VYUPJPKZPDVBKB-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 94.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.64 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|