C37H40F2N4O6 — CID 143025840
1-N-[[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]methyl]-1-N'-(4-fluorophenyl)-2,2-dimethylcyclopropane-1,1-dicarboxamide (PubChem CID 143025840) has the molecular formula C37H40F2N4O6 and a molecular weight of 674.75 g/mol. Its IUPAC name is 1-N-[[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]methyl]-1-N'-(4-fluorophenyl)-2,2-dimethylcyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N-[[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]methyl]-1-N'-(4-fluorophenyl)-2,2-dimethylcyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 143025840 |
| Molecular Formula | C37H40F2N4O6 |
| Molecular Weight | 674.75 g/mol |
| Exact Mass | 674.29 |
| IUPAC Name | 1-N-[[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]methyl]-1-N'-(4-fluorophenyl)-2,2-dimethylcyclopropane-1,1-dicarboxamide |
| SMILES | COc1cc2c(Oc3ccc(CNC(=O)C4(C(=O)Nc5ccc(F)cc5)CC4(C)C)cc3F)ccnc2cc1OCCCN1CCOCC1 |
| InChI | InChI=1S/C37H40F2N4O6/c1-36(2)23-37(36,35(45)42-26-8-6-25(38)7-9-26)34(44)41-22-24-5-10-31(28(39)19-24)49-30-11-12-40-29-21-33(32(46-3)20-27(29)30)48-16-4-13-43-14-17-47-18-15-43/h5-12,19-21H,4,13-18,22-23H2,1-3H3,(H,41,44)(H,42,45) |
| InChIKey | DHHYDUYVOQZLMK-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 111.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.75 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|