C31H34N4O4 — CID 166450521
1-[4-[6-methoxy-2-methyl-7-(2-piperidin-1-ylethoxy)quinolin-3-yl]oxyphenyl]-3-phenylurea (PubChem CID 166450521) has the molecular formula C31H34N4O4 and a molecular weight of 526.64 g/mol. Its IUPAC name is 1-[4-[6-methoxy-2-methyl-7-(2-piperidin-1-ylethoxy)quinolin-3-yl]oxyphenyl]-3-phenylurea.
| Compound Name | 1-[4-[6-methoxy-2-methyl-7-(2-piperidin-1-ylethoxy)quinolin-3-yl]oxyphenyl]-3-phenylurea |
|---|---|
| PubChem CID | 166450521 |
| Molecular Formula | C31H34N4O4 |
| Molecular Weight | 526.64 g/mol |
| Exact Mass | 526.26 |
| IUPAC Name | 1-[4-[6-methoxy-2-methyl-7-(2-piperidin-1-ylethoxy)quinolin-3-yl]oxyphenyl]-3-phenylurea |
| SMILES | COc1cc2cc(Oc3ccc(NC(=O)Nc4ccccc4)cc3)c(C)nc2cc1OCCN1CCCCC1 |
| InChI | InChI=1S/C31H34N4O4/c1-22-28(39-26-13-11-25(12-14-26)34-31(36)33-24-9-5-3-6-10-24)19-23-20-29(37-2)30(21-27(23)32-22)38-18-17-35-15-7-4-8-16-35/h3,5-6,9-14,19-21H,4,7-8,15-18H2,1-2H3,(H2,33,34,36) |
| InChIKey | YOGXFVAJZQGEMK-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 84.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.64 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |