C25H20Cl2N2O4 — CID 155812930
3,5-dichloro-N-[4-(6,7-dimethoxy-2-methylquinolin-3-yl)oxyphenyl]benzamide (PubChem CID 155812930) has the molecular formula C25H20Cl2N2O4 and a molecular weight of 483.35 g/mol. Its IUPAC name is 3,5-dichloro-N-[4-(6,7-dimethoxy-2-methylquinolin-3-yl)oxyphenyl]benzamide.
| Compound Name | 3,5-dichloro-N-[4-(6,7-dimethoxy-2-methylquinolin-3-yl)oxyphenyl]benzamide |
|---|---|
| PubChem CID | 155812930 |
| Molecular Formula | C25H20Cl2N2O4 |
| Molecular Weight | 483.35 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | 3,5-dichloro-N-[4-(6,7-dimethoxy-2-methylquinolin-3-yl)oxyphenyl]benzamide |
| SMILES | COc1cc2cc(Oc3ccc(NC(=O)c4cc(Cl)cc(Cl)c4)cc3)c(C)nc2cc1OC |
| InChI | InChI=1S/C25H20Cl2N2O4/c1-14-22(10-15-11-23(31-2)24(32-3)13-21(15)28-14)33-20-6-4-19(5-7-20)29-25(30)16-8-17(26)12-18(27)9-16/h4-13H,1-3H3,(H,29,30) |
| InChIKey | PZRLTBVFDVEDNH-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.35 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |