C34H36N4O5 — CID 90004359
1-N-[4-(6,7-dimethoxyquinolin-2-yl)oxyphenyl]-1-N'-[2-(piperidin-1-ylmethyl)phenyl]cyclopropane-1,1-dicarboxamide (PubChem CID 90004359) has the molecular formula C34H36N4O5 and a molecular weight of 580.69 g/mol. Its IUPAC name is 1-N-[4-(6,7-dimethoxyquinolin-2-yl)oxyphenyl]-1-N'-[2-(piperidin-1-ylmethyl)phenyl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N-[4-(6,7-dimethoxyquinolin-2-yl)oxyphenyl]-1-N'-[2-(piperidin-1-ylmethyl)phenyl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 90004359 |
| Molecular Formula | C34H36N4O5 |
| Molecular Weight | 580.69 g/mol |
| Exact Mass | 580.27 |
| IUPAC Name | 1-N-[4-(6,7-dimethoxyquinolin-2-yl)oxyphenyl]-1-N'-[2-(piperidin-1-ylmethyl)phenyl]cyclopropane-1,1-dicarboxamide |
| SMILES | COc1cc2ccc(Oc3ccc(NC(=O)C4(C(=O)Nc5ccccc5CN5CCCCC5)CC4)cc3)nc2cc1OC |
| InChI | InChI=1S/C34H36N4O5/c1-41-29-20-23-10-15-31(36-28(23)21-30(29)42-2)43-26-13-11-25(12-14-26)35-32(39)34(16-17-34)33(40)37-27-9-5-4-8-24(27)22-38-18-6-3-7-19-38/h4-5,8-15,20-21H,3,6-7,16-19,22H2,1-2H3,(H,35,39)(H,37,40) |
| InChIKey | KVSYKLQQASMTCD-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 102.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.69 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|