C24H28N4O4 — CID 55677079
2-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[2-(pyrrolidin-1-ylmethyl)phenyl]acetamide (PubChem CID 55677079) has the molecular formula C24H28N4O4 and a molecular weight of 436.51 g/mol. Its IUPAC name is 2-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[2-(pyrrolidin-1-ylmethyl)phenyl]acetamide.
| Compound Name | 2-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[2-(pyrrolidin-1-ylmethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 55677079 |
| Molecular Formula | C24H28N4O4 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | 2-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[2-(pyrrolidin-1-ylmethyl)phenyl]acetamide |
| SMILES | COc1ccc(C2(C)NC(=O)N(CC(=O)Nc3ccccc3CN3CCCC3)C2=O)cc1 |
| InChI | InChI=1S/C24H28N4O4/c1-24(18-9-11-19(32-2)12-10-18)22(30)28(23(31)26-24)16-21(29)25-20-8-4-3-7-17(20)15-27-13-5-6-14-27/h3-4,7-12H,5-6,13-16H2,1-2H3,(H,25,29)(H,26,31) |
| InChIKey | ULJMZIJAHQGSNR-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|