C20H25N3O — CID 131894977
2,6-dimethyl-N-[2-(piperidin-1-ylmethyl)phenyl]pyridine-4-carboxamide (PubChem CID 131894977) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is 2,6-dimethyl-N-[2-(piperidin-1-ylmethyl)phenyl]pyridine-4-carboxamide.
| Compound Name | 2,6-dimethyl-N-[2-(piperidin-1-ylmethyl)phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 131894977 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 2,6-dimethyl-N-[2-(piperidin-1-ylmethyl)phenyl]pyridine-4-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccccc2CN2CCCCC2)cc(C)n1 |
| InChI | InChI=1S/C20H25N3O/c1-15-12-18(13-16(2)21-15)20(24)22-19-9-5-4-8-17(19)14-23-10-6-3-7-11-23/h4-5,8-9,12-13H,3,6-7,10-11,14H2,1-2H3,(H,22,24) |
| InChIKey | CKOHUSXWBHFJPF-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |