C19H20F2N2OS — CID 55676837
4-(difluoromethylsulfanyl)-N-[2-(pyrrolidin-1-ylmethyl)phenyl]benzamide (PubChem CID 55676837) has the molecular formula C19H20F2N2OS and a molecular weight of 362.45 g/mol. Its IUPAC name is 4-(difluoromethylsulfanyl)-N-[2-(pyrrolidin-1-ylmethyl)phenyl]benzamide.
| Compound Name | 4-(difluoromethylsulfanyl)-N-[2-(pyrrolidin-1-ylmethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 55676837 |
| Molecular Formula | C19H20F2N2OS |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 4-(difluoromethylsulfanyl)-N-[2-(pyrrolidin-1-ylmethyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccccc1CN1CCCC1)c1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C19H20F2N2OS/c20-19(21)25-16-9-7-14(8-10-16)18(24)22-17-6-2-1-5-15(17)13-23-11-3-4-12-23/h1-2,5-10,19H,3-4,11-13H2,(H,22,24) |
| InChIKey | ICIXWJHMSJCXPT-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |