C34H36N4O3 — CID 90004898
1-N-[4-(6,7-dimethylquinolin-4-yl)oxyphenyl]-1-N'-[3-(piperidin-1-ylmethyl)phenyl]cyclopropane-1,1-dicarboxamide (PubChem CID 90004898) has the molecular formula C34H36N4O3 and a molecular weight of 548.69 g/mol. Its IUPAC name is 1-N-[4-(6,7-dimethylquinolin-4-yl)oxyphenyl]-1-N'-[3-(piperidin-1-ylmethyl)phenyl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N-[4-(6,7-dimethylquinolin-4-yl)oxyphenyl]-1-N'-[3-(piperidin-1-ylmethyl)phenyl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 90004898 |
| Molecular Formula | C34H36N4O3 |
| Molecular Weight | 548.69 g/mol |
| Exact Mass | 548.28 |
| IUPAC Name | 1-N-[4-(6,7-dimethylquinolin-4-yl)oxyphenyl]-1-N'-[3-(piperidin-1-ylmethyl)phenyl]cyclopropane-1,1-dicarboxamide |
| SMILES | Cc1cc2nccc(Oc3ccc(NC(=O)C4(C(=O)Nc5cccc(CN6CCCCC6)c5)CC4)cc3)c2cc1C |
| InChI | InChI=1S/C34H36N4O3/c1-23-19-29-30(20-24(23)2)35-16-13-31(29)41-28-11-9-26(10-12-28)36-32(39)34(14-15-34)33(40)37-27-8-6-7-25(21-27)22-38-17-4-3-5-18-38/h6-13,16,19-21H,3-5,14-15,17-18,22H2,1-2H3,(H,36,39)(H,37,40) |
| InChIKey | GJDWFQRDCKYQFW-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.69 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|