C28H24FN3O5 — CID 162785606
1-N-[4-[6,7-bis(hydroxymethyl)quinolin-4-yl]oxyphenyl]-1-N'-(3-fluorophenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 162785606) has the molecular formula C28H24FN3O5 and a molecular weight of 501.51 g/mol. Its IUPAC name is 1-N-[4-[6,7-bis(hydroxymethyl)quinolin-4-yl]oxyphenyl]-1-N'-(3-fluorophenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N-[4-[6,7-bis(hydroxymethyl)quinolin-4-yl]oxyphenyl]-1-N'-(3-fluorophenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 162785606 |
| Molecular Formula | C28H24FN3O5 |
| Molecular Weight | 501.51 g/mol |
| Exact Mass | 501.17 |
| IUPAC Name | 1-N-[4-[6,7-bis(hydroxymethyl)quinolin-4-yl]oxyphenyl]-1-N'-(3-fluorophenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | O=C(Nc1ccc(Oc2ccnc3cc(CO)c(CO)cc23)cc1)C1(C(=O)Nc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C28H24FN3O5/c29-19-2-1-3-21(14-19)32-27(36)28(9-10-28)26(35)31-20-4-6-22(7-5-20)37-25-8-11-30-24-13-18(16-34)17(15-33)12-23(24)25/h1-8,11-14,33-34H,9-10,15-16H2,(H,31,35)(H,32,36) |
| InChIKey | FRKBIRJDMGNLNZ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 120.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.51 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|