C28H24FN3O5 — CID 138463596
1-N'-(4-fluoro-3-methylphenyl)-1-N-[4-(6-hydroxy-7-methoxyquinolin-4-yl)oxyphenyl]cyclopropane-1,1-dicarboxamide (PubChem CID 138463596) has the molecular formula C28H24FN3O5 and a molecular weight of 501.51 g/mol. Its IUPAC name is 1-N'-(4-fluoro-3-methylphenyl)-1-N-[4-(6-hydroxy-7-methoxyquinolin-4-yl)oxyphenyl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-(4-fluoro-3-methylphenyl)-1-N-[4-(6-hydroxy-7-methoxyquinolin-4-yl)oxyphenyl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 138463596 |
| Molecular Formula | C28H24FN3O5 |
| Molecular Weight | 501.51 g/mol |
| Exact Mass | 501.17 |
| IUPAC Name | 1-N'-(4-fluoro-3-methylphenyl)-1-N-[4-(6-hydroxy-7-methoxyquinolin-4-yl)oxyphenyl]cyclopropane-1,1-dicarboxamide |
| SMILES | COc1cc2nccc(Oc3ccc(NC(=O)C4(C(=O)Nc5ccc(F)c(C)c5)CC4)cc3)c2cc1O |
| InChI | InChI=1S/C28H24FN3O5/c1-16-13-18(5-8-21(16)29)32-27(35)28(10-11-28)26(34)31-17-3-6-19(7-4-17)37-24-9-12-30-22-15-25(36-2)23(33)14-20(22)24/h3-9,12-15,33H,10-11H2,1-2H3,(H,31,34)(H,32,35) |
| InChIKey | GZXZWYNVGFKYQL-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 109.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.51 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|